CAS 59255-95-7 appears in our catalog under these names: 2-Bromo-6-nitroaniline, 95%, 95%, 2-Bromo-6-nitroaniline 95%, 2-Bromo-6-nitroaniline, 95%, 2-Bromo-6-nitroaniline. Offered by: Chemat, Ambeed, Fluorochem, TRC. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
2-bromo-6-nitroaniline (CAS 59255-95-7) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-6-nitroaniline. InChIKey: KKMOSYLWYLMHAL-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-6-nitroaniline |
| InChIKey | KKMOSYLWYLMHAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)