CAS 59291-87-1 is the registry number for 5-(Benzyloxy)resorcinol. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
5-phenylmethoxybenzene-1,3-diol (CAS 59291-87-1) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 5-phenylmethoxybenzene-1,3-diol. InChIKey: NVOJWBBMMVWYGJ-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 5-phenylmethoxybenzene-1,3-diol |
| InChIKey | NVOJWBBMMVWYGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)O)O |
Computed by PubChem (NCBI)