CAS 59342-31-3 appears in our catalog under these names: 2-Hydrazinoquinazolin-4(3h)-one, 95%, 2-Hydrazinylquinazolin-4(3H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 10g.
2-hydrazinyl-3H-quinazolin-4-one (CAS 59342-31-3) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 2-hydrazinyl-3H-quinazolin-4-one. InChIKey: UCFYYWZQWKEOOI-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 2-hydrazinyl-3H-quinazolin-4-one |
| InChIKey | UCFYYWZQWKEOOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)NN |
Computed by PubChem (NCBI)