CAS 59443-15-1 appears in our catalog under these names: 3'-Bromo-5'-chloro-2'-hydroxyacetophenone, 97%, 3'–Bromo–5'–chloro–2'–hydroxyacetophenone, 3'-Bromo-5'-chloro-2'-hydroxyacetophenone, >97.0%(GC)(T), 3'-Bromo-5'-chloro-2'-hydroxyacetophenone 98%, 1-(3-Bromo-5-chloro-2-hydroxyphenyl)ethanone, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 500g, 5g, 10g.
1-(3-bromo-5-chloro-2-hydroxyphenyl)ethanone (CAS 59443-15-1) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 1-(3-bromo-5-chloro-2-hydroxyphenyl)ethanone. InChIKey: FFAVKFQPEOGJOA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 1-(3-bromo-5-chloro-2-hydroxyphenyl)ethanone |
| InChIKey | FFAVKFQPEOGJOA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Cl)Br)O |
Computed by PubChem (NCBI)