Products 5946-43-0

CAS 5946-43-0 is the registry number for Methyl 2-(2-bromoacetamido)benzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[(2-bromoacetyl)amino]benzoate (CAS 5946-43-0) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: methyl 2-[(2-bromoacetyl)amino]benzoate. InChIKey: BTRCQDXXRNYMAS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrNO3
Molecular weight272.09 g/mol
IUPAC namemethyl 2-[(2-bromoacetyl)amino]benzoate
InChIKeyBTRCQDXXRNYMAS-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1NC(=O)CBr

Computed by PubChem (NCBI)