Products 59496-25-2
CAS 59496-25-2 appears in our catalog under these names: 1H-Indole-3-carbonyl chloride, 95%, 1H-Indole-3-carbonyl chloride, 1H-Indole-3-carbonyl chloride, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g.
1H-indole-3-carbonyl chloride (CAS 59496-25-2) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 1H-indole-3-carbonyl chloride. InChIKey: IIJFYTVJRDKVCI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 1H-indole-3-carbonyl chloride |
| InChIKey | IIJFYTVJRDKVCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)Cl |
Computed by PubChem (NCBI)