CAS 595610-41-6 is the registry number for Ethyl 5-(4-methylphenyl)-2H-pyrazole-3-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
Ethyl 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate (CAS 595610-41-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: ethyl 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate. InChIKey: VGQLKLIHKUWTGS-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | ethyl 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | VGQLKLIHKUWTGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)