Products 59618-44-9
CAS 59618-44-9 is the registry number for 4-(3-Methylphenyl)-4-oxobutyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(3-methylphenyl)-4-oxobutanoic acid (CAS 59618-44-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 4-(3-methylphenyl)-4-oxobutanoic acid. InChIKey: NZHPMZMVALJALH-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 4-(3-methylphenyl)-4-oxobutanoic acid |
| InChIKey | NZHPMZMVALJALH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(3-Methylphenyl)-4-oxobutyric acid, 4-(3-methylphenyl)-4-oxobutanoic acid, 4-Oxo-4-(m-tolyl)butanoic acid, 3-(m-toluoyl)propionic acid, 4-Oxo-4-(m-tolyl)butanoicacid, 3-(5-methylbenzoyl)propionic acid, 4-(m-tolyl)-4-oxo-butanoic acid, 3-Methyl-gamma-oxobenzenebutanoic acid, Benzenebutanoic acid, 3-methyl-gamma-oxo-