Products 59643-82-2
CAS 59643-82-2 is the registry number for N-Ethyl-Adrenalone Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
1-(3,4-dihydroxyphenyl)-2-[ethyl(methyl)amino]ethanone;hydrochloride (CAS 59643-82-2) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 1-(3,4-dihydroxyphenyl)-2-[ethyl(methyl)amino]ethanone;hydrochloride. InChIKey: XOODHQFEFZXAME-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 1-(3,4-dihydroxyphenyl)-2-[ethyl(methyl)amino]ethanone;hydrochloride |
| InChIKey | XOODHQFEFZXAME-UHFFFAOYSA-N |
| SMILES | CCN(C)CC(=O)C1=CC(=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
N-Ethyl-Adrenalone Hydrochloride