CAS 59691-14-4 appears in our catalog under these names: 3-Amino-4-propoxybenzoic Acid Hydrochloride, Proparacaine Impurity 1. Offered by: Mikromol, Chemat Brand. Available pack sizes: 4x25mg, 25mg, 100mg, on request.
3-amino-4-propoxybenzoic acid;hydrochloride (CAS 59691-14-4) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: 3-amino-4-propoxybenzoic acid;hydrochloride. InChIKey: GGERISRWDATJBJ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 3-amino-4-propoxybenzoic acid;hydrochloride |
| InChIKey | GGERISRWDATJBJ-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)