CAS 597561-78-9 appears in our catalog under these names: 4-(Oxazol-2-yl)benzoic acid, 98%, 4-(Oxazol-2-yl)benzoic acid, 97%, 4-(Oxazol-2-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-(1,3-oxazol-2-yl)benzoic acid (CAS 597561-78-9) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(1,3-oxazol-2-yl)benzoic acid. InChIKey: NSWZKCPOERCLNH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-(1,3-oxazol-2-yl)benzoic acid |
| InChIKey | NSWZKCPOERCLNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CO2)C(=O)O |
Computed by PubChem (NCBI)