CAS 59825-75-1 appears in our catalog under these names: 5-(2-Bromoethoxy)-2H-1,3-benzodioxole, 95%, 5-(2-Bromoethoxy)-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(2-bromoethoxy)-1,3-benzodioxole (CAS 59825-75-1) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 5-(2-bromoethoxy)-1,3-benzodioxole. InChIKey: URIVYBLQEIFBAU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 5-(2-bromoethoxy)-1,3-benzodioxole |
| InChIKey | URIVYBLQEIFBAU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OCCBr |
Computed by PubChem (NCBI)