Products 59887-99-9
CAS 59887-99-9 is the registry number for 7,8-Dihydroxy-4H-chromen-4-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,8-dihydroxychromen-4-one (CAS 59887-99-9) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 7,8-dihydroxychromen-4-one. InChIKey: WWGFXSLWIRYIBP-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 7,8-dihydroxychromen-4-one |
| InChIKey | WWGFXSLWIRYIBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C=CO2)O)O |
Computed by PubChem (NCBI)