CAS 59899-84-2 is the registry number for (5-Fluoro-1,2-benzoxazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-fluoro-1,2-benzoxazol-3-yl)methanamine;hydrochloride (CAS 59899-84-2) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: (5-fluoro-1,2-benzoxazol-3-yl)methanamine;hydrochloride. InChIKey: ZPTVSTREZLQPMM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | (5-fluoro-1,2-benzoxazol-3-yl)methanamine;hydrochloride |
| InChIKey | ZPTVSTREZLQPMM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=NO2)CN.Cl |
Computed by PubChem (NCBI)