CAS 599-61-1 appears in our catalog under these names: Bis(3-Aminophenyl) Sulfone, 3,3'-Diaminodiphenyl sulfone, 98% , 3-Aminophenyl sulfone, 98.00%, Bis(3-aminophenyl) Sulfone, >98.0%(T), 3,3'-Sulfonyldianiline 97%. Offered by: TRC, Thermo Scientific (Alfa Aesar), Chemat, TCI, Ambeed. Available pack sizes: 10g, 1g, 50g, 25g, 100g, 500g, 1000g, 250g.
3-(3-aminophenyl)sulfonylaniline (CAS 599-61-1) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 3-(3-aminophenyl)sulfonylaniline. InChIKey: LJGHYPLBDBRCRZ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 3-(3-aminophenyl)sulfonylaniline |
| InChIKey | LJGHYPLBDBRCRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)C2=CC=CC(=C2)N)N |
Computed by PubChem (NCBI)