Products 59935-47-6
CAS 59935-47-6 is the registry number for ALR2-IN-7, 99.94%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 100 mg, 25 mg, 10mM/1mL, 50 mg.
4-(9H-fluoren-2-ylamino)-4-oxobutanoic acid (CAS 59935-47-6) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 4-(9H-fluoren-2-ylamino)-4-oxobutanoic acid. InChIKey: GTWRPNCMRGJTMD-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 4-(9H-fluoren-2-ylamino)-4-oxobutanoic acid |
| InChIKey | GTWRPNCMRGJTMD-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C=C(C=C3)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
N-2-Fluorenylsuccinamic acid, FLSUA, 4-(9H-fluoren-2-ylamino)-4-oxobutanoic acid, 4-((9H-Fluoren-2-yl)amino)-4-oxobutanoic acid, Butanoic acid, 4-(9H-fluoren-2-ylamino)-4-oxo-, 4-[(9H-Fluoren-2-yl)amino]-4-oxobutanoic acid, Oprea1_443316, orb3136581, 4-((9H-Fluoren-2-yl)amino)-4-oxobutanoicacid