CAS 59969-65-2 appears in our catalog under these names: (2S,3R)-3-(((Benzyloxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid, 95%, 95%, (2S,3R)-3-(((Benzyloxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid, 98%, (2S,3R)-3-(((Benzyloxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g.
(2S,3R)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 59969-65-2) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: (2S,3R)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: JXJYTERRLRAUSF-CVEARBPZSA-N.
| Molecular formula | C18H19NO5 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (2S,3R)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | JXJYTERRLRAUSF-CVEARBPZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H]([C@@H](C(=O)O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)