CAS 59992-52-8 is the registry number for 3,5-Dichloro-4-nitroaniline. Offered by: TRC. Available pack sizes: 500mg.
3,5-dichloro-4-nitroaniline (CAS 59992-52-8) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3,5-dichloro-4-nitroaniline. InChIKey: FKDUHJWERVIMAL-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3,5-dichloro-4-nitroaniline |
| InChIKey | FKDUHJWERVIMAL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)[N+](=O)[O-])Cl)N |
Computed by PubChem (NCBI)