CAS 60010-03-9 appears in our catalog under these names: 2,6-Dichloro-4-methyl-3-nitropyridine 98%, 2,6-Dichloro-4-methyl-3-nitropyridine, 98%, 98%, 2,6-Dichloro-4-methyl-3-nitropyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 50g, 100g.
2,6-dichloro-4-methyl-3-nitropyridine (CAS 60010-03-9) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,6-dichloro-4-methyl-3-nitropyridine. InChIKey: CMJNIYUZFQWYCK-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,6-dichloro-4-methyl-3-nitropyridine |
| InChIKey | CMJNIYUZFQWYCK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)