Products 60113-11-3
CAS 60113-11-3 appears in our catalog under these names: CBDB, (1'R,2'R)-4-Butyl-5'-methyl-2'-(prop-1-en-2-yl)-1',2',3',4'-tetrahydro-[1,1'-biphenyl]-2,6-diol, 95%, 95%, Cannabidiol-C4, 99.5%, Cannabidibutol (cbdb). Offered by: GLPBio, Chemat, MedChemExpress, Supelco. Available pack sizes: 1mg, 5mg, 100mg, 1 mg, 1ML.
5-butyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol (CAS 60113-11-3) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: 5-butyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol. InChIKey: WBRXESQKGXYDOL-DLBZAZTESA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 5-butyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol |
| InChIKey | WBRXESQKGXYDOL-DLBZAZTESA-N |
| SMILES | CCCCC1=CC(=C(C(=C1)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O |
Computed by PubChem (NCBI)