Products 60233-25-2
CAS 60233-25-2 appears in our catalog under these names: 2,2',3',4,6-Pentachlorobiphenyl, PCB 98, ROTI®Star, 5 mg, glass, PCB 98, PCB 98, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: TRC, Roth, HPC Standards. Available pack sizes: 10mg, 5mg, 1x5mg, 1x5ml.
1,3,5-trichloro-2-(2,3-dichlorophenyl)benzene (CAS 60233-25-2) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,3,5-trichloro-2-(2,3-dichlorophenyl)benzene. InChIKey: GOFFZTAPOOICFT-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,3,5-trichloro-2-(2,3-dichlorophenyl)benzene |
| InChIKey | GOFFZTAPOOICFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,2',3,4',6'-Pentachloro-1,1'-biphenyl, 2,3,2',4',6'-Pentachlorobiphenyl, 1,1'-Biphenyl, 2,3,2',4',6'-pentachloro-, 1,1'-Biphenyl, 2,2',3,4',6'-Pentachloro-, 1,3,5-trichloro-2-(2,3-dichlorophenyl)benzene, Pcb No. 98, 1,1'-Biphenyl, 2,2',3',4,6-Pentachloro-, GOFFZTAPOOICFT-UHFFFAOYSA-N, 2,2',3,4',6'-Pentachloro-1,1'-biphenyl #