Products 60263-63-0
CAS 60263-63-0 appears in our catalog under these names: rac-Methadone-D3 0.1 mg/ml in Methanol, rac-Methadone-D3 1.0 mg/ml in Methanol, (±)–Methadone–d3, (±)–Methadone–d3 (CRM). Offered by: LoGiCal, GLPBio. Available pack sizes: 1ml, 1mg, 5mg, 100μg.
1,1,1-trideuterio-6-(dimethylamino)-4,4-diphenylheptan-3-one (CAS 60263-63-0) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 312.5 g/mol. IUPAC name: 1,1,1-trideuterio-6-(dimethylamino)-4,4-diphenylheptan-3-one. InChIKey: USSIQXCVUWKGNF-FIBGUPNXSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | 1,1,1-trideuterio-6-(dimethylamino)-4,4-diphenylheptan-3-one |
| InChIKey | USSIQXCVUWKGNF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)C(CC(C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)