Products 6036-00-6
CAS 6036-00-6 appears in our catalog under these names: 2–Naphthalenesulfonic Acid Monohydrate, 2-Naphthalenesulfonicacidhydrate 98% (contains <35%H2O), Naphthalene-2-sulfonic acid hydrate, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 500g, 100g, 1g, 25g.
Naphthalene-2-sulfonic acid;hydrate (CAS 6036-00-6) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: naphthalene-2-sulfonic acid;hydrate. InChIKey: HKGOFWIZZIYCOS-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | naphthalene-2-sulfonic acid;hydrate |
| InChIKey | HKGOFWIZZIYCOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)O.O |
Computed by PubChem (NCBI)
Synonyms:
Naphthalene-2-sulfonic acid--water (1/1), Naphthalene-2-sulfonic acid hydrate, 2-naphthalenesulfonic acid hydrate, 2-Naphthalenesulfonic acid, hydrate (1:x), naphthalene-2-sulfonic acid;hydrate, 2-Naphthalenesulfonic acid monohydrate, 2-naphthalene-sulfonic acid monohydrate, naphthalene-2-sulphonic acid monohydrate