Products 76530-12-6
CAS 76530-12-6 appears in our catalog under these names: 2–Naphthalenesulfonic Acid Hydrate, 2-Naphthalenesulfonic acid hydrate, 90%, technical, 2-Naphthalenesulfonic Acid Hydrate, >98.0%(HPLC)(T), 2-Naphthalenesulfonic acid, hydrate (1:x), 2-Naphthalenesulfonic acid hydrate. Offered by: GLPBio, Thermo Scientific (Acros), TCI, Chemat, HPC Standards. Available pack sizes: 500g, 5g, 25g, 100g, 1x250mg.
Naphthalene-2-sulfonic acid;hydrate (CAS 76530-12-6) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: naphthalene-2-sulfonic acid;hydrate. InChIKey: HKGOFWIZZIYCOS-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | naphthalene-2-sulfonic acid;hydrate |
| InChIKey | HKGOFWIZZIYCOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)O.O |
Computed by PubChem (NCBI)
Synonyms:
Naphthalene-2-sulfonic acid--water (1/1), Naphthalene-2-sulfonic acid hydrate, 2-naphthalenesulfonic acid hydrate, 2-Naphthalenesulfonic acid, hydrate (1:x), naphthalene-2-sulfonic acid;hydrate, 2-Naphthalenesulfonic acid monohydrate, 2-naphthalene-sulfonic acid monohydrate, naphthalene-2-sulphonic acid monohydrate