Products 60424-17-1
CAS 60424-17-1 is the registry number for Naproxen Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(5-methoxynaphthalen-2-yl)propanoic acid (CAS 60424-17-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: (2S)-2-(5-methoxynaphthalen-2-yl)propanoic acid. InChIKey: ICRSDYDMKBXRSR-VIFPVBQESA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S)-2-(5-methoxynaphthalen-2-yl)propanoic acid |
| InChIKey | ICRSDYDMKBXRSR-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C(=CC=C2)OC)C(=O)O |
Computed by PubChem (NCBI)