CAS 605-62-9 appears in our catalog under these names: KAT8–IN–1, 4-Nitro-1-naphthol, >98.0%(T), KAT8-IN-1 98%, 4-Nitro-1-naphthol, 98%, 98%, KAT8-IN-1, 99.61%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 500g, 5 g, 10mM/1mL.
4-nitronaphthalen-1-ol (CAS 605-62-9) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 4-nitronaphthalen-1-ol. InChIKey: AUIRNGLMBHIITH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-nitronaphthalen-1-ol |
| InChIKey | AUIRNGLMBHIITH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)[N+](=O)[O-] |
Computed by PubChem (NCBI)