Products 6059-44-5

CAS 6059-44-5 is the registry number for Methyl 2,3-diaminopropanoate dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,3-diaminopropanoate;dihydrochloride (CAS 6059-44-5) is a chemical compound with the molecular formula C4H12Cl2N2O2 and a molecular weight of 191.05 g/mol. IUPAC name: methyl 2,3-diaminopropanoate;dihydrochloride. InChIKey: MIOQZKCEDSNQNA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H12Cl2N2O2
Molecular weight191.05 g/mol
IUPAC namemethyl 2,3-diaminopropanoate;dihydrochloride
InChIKeyMIOQZKCEDSNQNA-UHFFFAOYSA-N
SMILESCOC(=O)C(CN)N.Cl.Cl

Computed by PubChem (NCBI)