Products 606-83-7
CAS 606-83-7 appears in our catalog under these names: 3,3-Diphenylpropionic Acid, 3,3–Diphenylpropionic acid, 3,3-Diphenylpropionic Acid, >97.0%(T), 3,3-Diphenylpropionic acid, 97%, 3,3-Diphenylpropionic acid 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 50g, 250g, 1kg, 0,5kg, 2kg, 5g.
3,3-diphenylpropanoic acid (CAS 606-83-7) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3,3-diphenylpropanoic acid. InChIKey: BZQGAPWJKAYCHR-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3,3-diphenylpropanoic acid |
| InChIKey | BZQGAPWJKAYCHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3,3-Diphenylpropionic acid, Diphenylpropionic acid, 3,3-Diphenylpropanoate, Propionic acid, 3,3-diphenyl-, 3,3-Diphenylpropanoic acid, beta-Phenylbenzenepropanoic acid, .beta.-Phenylbenzenepropanoic acid, Benzenepropanoic acid, .beta.-phenyl-, Hydrocinnamic acid, beta-phenyl-, 3,3 diphenylpropionic acid