CAS 606091-79-6 is the registry number for 2-Chloro-3-ethyl-6,8-dimethylquinoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-ethyl-6,8-dimethylquinoline (CAS 606091-79-6) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 2-chloro-3-ethyl-6,8-dimethylquinoline. InChIKey: INQIOVBUHXYDQE-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 2-chloro-3-ethyl-6,8-dimethylquinoline |
| InChIKey | INQIOVBUHXYDQE-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=CC(=CC(=C2N=C1Cl)C)C |
Computed by PubChem (NCBI)