CAS 60640-63-3 appears in our catalog under these names: Methyl 4-(3-hydroxyphenyl)-2,4-dioxobutanoate, Methyl 4-(3-hydroxyphenyl)-2,4-dioxobutanoate, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
Methyl 4-(3-hydroxyphenyl)-2,4-dioxobutanoate (CAS 60640-63-3) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: methyl 4-(3-hydroxyphenyl)-2,4-dioxobutanoate. InChIKey: FKIUBGJCNKLEDS-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | methyl 4-(3-hydroxyphenyl)-2,4-dioxobutanoate |
| InChIKey | FKIUBGJCNKLEDS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)