Products 60671-62-7
CAS 60671-62-7 is the registry number for KF-392. Offered by: MedChemExpress. Available pack sizes: Get quote.
Azane;3-carbamoyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 60671-62-7) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: azane;3-carbamoyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: UTBRKYJEXZKRGY-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | azane;3-carbamoyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | UTBRKYJEXZKRGY-UHFFFAOYSA-N |
| SMILES | C1=CC2C(C(C1O2)C(=O)N)C(=O)O.N |
Computed by PubChem (NCBI)