CAS 60676-84-8 is the registry number for MMDA Hydrochloride. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-amine;hydrochloride (CAS 60676-84-8) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-amine;hydrochloride. InChIKey: HULCPMREEFWFRE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 1-(7-methoxy-1,3-benzodioxol-5-yl)propan-2-amine;hydrochloride |
| InChIKey | HULCPMREEFWFRE-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C(=C1)OC)OCO2)N.Cl |
Computed by PubChem (NCBI)