CAS 607-24-9 appears in our catalog under these names: 2-Nitronaphthalen-1-ol, >98.0%(GC)(T), 2-Nitro-1-naphthol 98%, 2-NITRO-1-NAPHTHOL, 95%, 2-Nitro-1-naphthol, 99%, 99%, 2-Nitro-1-naphthol, 96%. Offered by: TCI, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 1000g, 10g, 25g, 100g, 500g, 1kg.
2-nitronaphthalen-1-ol (CAS 607-24-9) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-nitronaphthalen-1-ol. InChIKey: MUCCHGOWMZTLHK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-nitronaphthalen-1-ol |
| InChIKey | MUCCHGOWMZTLHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)[N+](=O)[O-] |
Computed by PubChem (NCBI)