CAS 60706-07-2 appears in our catalog under these names: 4-Chloro-7-methoxyindoline-2,3-dione, 95+%, 4-Chloro-7-methoxyindoline-2,3-dione, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-chloro-7-methoxy-1H-indole-2,3-dione (CAS 60706-07-2) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 4-chloro-7-methoxy-1H-indole-2,3-dione. InChIKey: VZPMNHWRRJFLFO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 4-chloro-7-methoxy-1H-indole-2,3-dione |
| InChIKey | VZPMNHWRRJFLFO-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Cl)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)