Products 60735-85-5
CAS 60735-85-5 is the registry number for Sotalol hydrochloride EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-[2-(propan-2-ylamino)acetyl]phenyl]methanesulfonamide (CAS 60735-85-5) is a chemical compound with the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. IUPAC name: N-[4-[2-(propan-2-ylamino)acetyl]phenyl]methanesulfonamide. InChIKey: BKXGLPPAZWSLEH-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | N-[4-[2-(propan-2-ylamino)acetyl]phenyl]methanesulfonamide |
| InChIKey | BKXGLPPAZWSLEH-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(=O)C1=CC=C(C=C1)NS(=O)(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Oxo sotalol, Sotalol hydrochloride specified impurity B [EP], N-(4-(((1-Methylethyl)amino)acetyl)phenyl)methanesulfonamide, Methanesulfonamide, N-(4-(2-((1-methylethyl)amino)acetyl)phenyl)-, SOTALOL HYDROCHLORIDE IMPURITY B [EP IMPURITY], SOTALOL HYDROCHLORIDE IMPURITY B (EP IMPURITY), Sotalol hydrochloride specified impurity B, N-[4-[2-(propan-2-ylamino)acetyl]phenyl]methanesulfonamide, N-(4-(2-(Isopropylamino)acetyl)phenyl)methanesulfonamide, Sotalol EP Impurity B