CAS 60756-73-2 appears in our catalog under these names: 2-(6-Hydroxynaphthalen-2-yl)propanoic acid, 2-(6-Hydroxynaphthalen-2-yl)propanoic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 25mg, 100mg.
2-(6-hydroxynaphthalen-2-yl)propanoic acid (CAS 60756-73-2) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 2-(6-hydroxynaphthalen-2-yl)propanoic acid. InChIKey: XWJUDDGELKXYNO-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 2-(6-hydroxynaphthalen-2-yl)propanoic acid |
| InChIKey | XWJUDDGELKXYNO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)