Products 608133-97-7
CAS 608133-97-7 is the registry number for (R)-2-Amino-3-(benzo[d][1,3]dioxol-5-yl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride (CAS 608133-97-7) is a chemical compound with the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. IUPAC name: (2R)-2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride. InChIKey: FECWNUOCBBWMGV-OGFXRTJISA-N.
| Molecular formula | C10H12ClNO4 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | (2R)-2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride |
| InChIKey | FECWNUOCBBWMGV-OGFXRTJISA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)