Products 77140-84-2
CAS 77140-84-2 is the registry number for 2–Amino–3–(benzo(d)(1,3)dioxol–5–yl)propanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride (CAS 77140-84-2) is a chemical compound with the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. IUPAC name: 2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride. InChIKey: FECWNUOCBBWMGV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride |
| InChIKey | FECWNUOCBBWMGV-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)