CAS 60964-09-2 appears in our catalog under these names: 2,6–Dichloro–4–hydroxybenzaldehyde, 2,6-Dichloro-4-hydroxybenzaldehyde 95%, 2,6-Dichloro-4-Hydroxybenzaldehyde, 95%, 95%, 2,6-Dichloro-4-hydroxybenzaldehyde, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 100g, 25g.
2,6-dichloro-4-hydroxybenzaldehyde (CAS 60964-09-2) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: 2,6-dichloro-4-hydroxybenzaldehyde. InChIKey: WWFRBIPLCLSKNH-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 2,6-dichloro-4-hydroxybenzaldehyde |
| InChIKey | WWFRBIPLCLSKNH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)O |
Computed by PubChem (NCBI)