CAS 610-57-1 is the registry number for 2,4-Dinitrobenzyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
1-(chloromethyl)-2,4-dinitrobenzene (CAS 610-57-1) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 1-(chloromethyl)-2,4-dinitrobenzene. InChIKey: DARDYTBLZQDXBK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2,4-dinitrobenzene |
| InChIKey | DARDYTBLZQDXBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)