CAS 61098-39-3 appears in our catalog under these names: 7-Chloro-5,6-dimethylpyrazolo(1,5-a)pyrimidine, 98%, 7-Chloro-5,6-dimethylpyrazolo(1,5-a)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
7-chloro-5,6-dimethylpyrazolo[1,5-a]pyrimidine (CAS 61098-39-3) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 7-chloro-5,6-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: LGJKMBCWZLRACP-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 7-chloro-5,6-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | LGJKMBCWZLRACP-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=CC=N2)N=C1C)Cl |
Computed by PubChem (NCBI)