CAS 612-52-2 appears in our catalog under these names: 2-Naphthylamine Hydrochloride, 2-Naphthylammonium chloride. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1x10mg.
Naphthalen-2-amine;hydrochloride (CAS 612-52-2) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: naphthalen-2-amine;hydrochloride. InChIKey: QKGIPGSKJBOHSL-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | naphthalen-2-amine;hydrochloride |
| InChIKey | QKGIPGSKJBOHSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)N.Cl |
Computed by PubChem (NCBI)