CAS 61248-78-0 is the registry number for (2R)-3-(1-Naphthalenyloxy)-1,2-propanediol. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
(2R)-3-naphthalen-1-yloxypropane-1,2-diol (CAS 61248-78-0) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-3-naphthalen-1-yloxypropane-1,2-diol. InChIKey: BYNNMWGWFIGTIC-LLVKDONJSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-3-naphthalen-1-yloxypropane-1,2-diol |
| InChIKey | BYNNMWGWFIGTIC-LLVKDONJSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OC[C@@H](CO)O |
Computed by PubChem (NCBI)