CAS 69533-57-9 appears in our catalog under these names: 3-(1-Naphthalenyloxy)-1,2-propanediol-d5, Propranolol glycol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 2.5 mg, 25 mg.
1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropane-1,2-diol (CAS 69533-57-9) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 223.28 g/mol. IUPAC name: 1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropane-1,2-diol. InChIKey: BYNNMWGWFIGTIC-QJHRKUAUSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 223.28 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuterio-3-naphthalen-1-yloxypropane-1,2-diol |
| InChIKey | BYNNMWGWFIGTIC-QJHRKUAUSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC2=CC=CC=C21)O)O |
Computed by PubChem (NCBI)