CAS 61292-49-7 appears in our catalog under these names: 1-(2-Nitrobenzyl)-1h-imidazole, 95%, 1-(2-Nitrobenzyl)-1H-imidazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
1-[(2-nitrophenyl)methyl]imidazole (CAS 61292-49-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-[(2-nitrophenyl)methyl]imidazole. InChIKey: GXVAHCGFGVRIHQ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-[(2-nitrophenyl)methyl]imidazole |
| InChIKey | GXVAHCGFGVRIHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=CN=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)