Products 613262-61-6
CAS 613262-61-6 is the registry number for M62812 (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2-aminophenoxy)-1,2-benzothiazol-3-amine (CAS 613262-61-6) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: 6-(2-aminophenoxy)-1,2-benzothiazol-3-amine. InChIKey: HQCTTYOADNAJJR-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 6-(2-aminophenoxy)-1,2-benzothiazol-3-amine |
| InChIKey | HQCTTYOADNAJJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC3=C(C=C2)C(=NS3)N |
Computed by PubChem (NCBI)