CAS 614-28-8 is the registry number for N-benzoylbenzamide. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzoylbenzamide (CAS 614-28-8) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: N-benzoylbenzamide. InChIKey: ZHDORMMHAKXTPT-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | N-benzoylbenzamide |
| InChIKey | ZHDORMMHAKXTPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)