CAS 61424-76-8 appears in our catalog under these names: 2-Amino-3-formylchromone, 98%, 2–Amino–3–formylchromone, 2-Amino-3-formylchromone, >98.0%(HPLC)(N), 2-Amino-4-oxo-4H-chromene-3-carbaldehyde 95%, 2-AMINO-3-FORMYLCHROMONE, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 250mg.
2-amino-4-oxochromene-3-carbaldehyde (CAS 61424-76-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-amino-4-oxochromene-3-carbaldehyde. InChIKey: TVGIYZVZBKAJRR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-amino-4-oxochromene-3-carbaldehyde |
| InChIKey | TVGIYZVZBKAJRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(O2)N)C=O |
Computed by PubChem (NCBI)