CAS 61553-69-3 is the registry number for 3-(2-Oxo-2-phenylethyl)-2H-1,4-benzoxazin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-phenacyl-1,4-benzoxazin-2-one (CAS 61553-69-3) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 3-phenacyl-1,4-benzoxazin-2-one. InChIKey: FQENJNZYUGCSGH-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 3-phenacyl-1,4-benzoxazin-2-one |
| InChIKey | FQENJNZYUGCSGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=NC3=CC=CC=C3OC2=O |
Computed by PubChem (NCBI)