CAS 616227-75-9 is the registry number for Brexpiprazole Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide (CAS 616227-75-9) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: (E)-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide. InChIKey: IIFFDQOHESPFOL-MDZDMXLPSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | (E)-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide |
| InChIKey | IIFFDQOHESPFOL-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)